C44H26F4N2S — CID 158165946
1,3-difluoro-2-[2-[4-(3-fluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-5-methylbenzene;2-fluoro-4-[4-[2-(4-methylphenyl)ethynyl]phenyl]benzonitrile (PubChem CID 158165946) has the molecular formula C44H26F4N2S and a molecular weight of 690.77 g/mol. Its IUPAC name is 1,3-difluoro-2-[2-[4-(3-fluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-5-methylbenzene;2-fluoro-4-[4-[2-(4-methylphenyl)ethynyl]phenyl]benzonitrile.
| Compound Name | 1,3-difluoro-2-[2-[4-(3-fluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-5-methylbenzene;2-fluoro-4-[4-[2-(4-methylphenyl)ethynyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 158165946 |
| Molecular Formula | C44H26F4N2S |
| Molecular Weight | 690.77 g/mol |
| Exact Mass | 690.18 |
| IUPAC Name | 1,3-difluoro-2-[2-[4-(3-fluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-5-methylbenzene;2-fluoro-4-[4-[2-(4-methylphenyl)ethynyl]phenyl]benzonitrile |
| SMILES | Cc1cc(F)c(C#Cc2ccc(-c3ccc(N=C=S)c(F)c3)cc2)c(F)c1.Cc1ccc(C#Cc2ccc(-c3ccc(C#N)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C22H12F3NS.C22H14FN/c1-14-10-19(23)18(20(24)11-14)8-4-15-2-5-16(6-3-15)17-7-9-22(26-13-27)21(25)12-17;1-16-2-4-17(5-3-16)6-7-18-8-10-19(11-9-18)20-12-13-21(15-24)22(23)14-20/h2-3,5-7,9-12H,1H3;2-5,8-14H,1H3 |
| InChIKey | FWVOAXDMIFBGOJ-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.77 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|