C23H21F3 — CID 139730083
1-[2-[4-(4,4-difluorocyclohexyl)phenyl]ethynyl]-2-fluoro-4-[(E)-prop-1-enyl]benzene (PubChem CID 139730083) has the molecular formula C23H21F3 and a molecular weight of 354.42 g/mol. Its IUPAC name is 1-[2-[4-(4,4-difluorocyclohexyl)phenyl]ethynyl]-2-fluoro-4-[(E)-prop-1-enyl]benzene.
| Compound Name | 1-[2-[4-(4,4-difluorocyclohexyl)phenyl]ethynyl]-2-fluoro-4-[(E)-prop-1-enyl]benzene |
|---|---|
| PubChem CID | 139730083 |
| Molecular Formula | C23H21F3 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-[2-[4-(4,4-difluorocyclohexyl)phenyl]ethynyl]-2-fluoro-4-[(E)-prop-1-enyl]benzene |
| SMILES | C/C=C/c1ccc(C#Cc2ccc(C3CCC(F)(F)CC3)cc2)c(F)c1 |
| InChI | InChI=1S/C23H21F3/c1-2-3-18-7-11-21(22(24)16-18)10-6-17-4-8-19(9-5-17)20-12-14-23(25,26)15-13-20/h2-5,7-9,11,16,20H,12-15H2,1H3/b3-2+ |
| InChIKey | BLRCEQYOBLLWBZ-NSCUHMNNSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|