C21H22F2 — CID 151822303
1-(3,3-difluorocyclohexyl)-4-(4-prop-1-enylphenyl)benzene (PubChem CID 151822303) has the molecular formula C21H22F2 and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-(3,3-difluorocyclohexyl)-4-(4-prop-1-enylphenyl)benzene.
| Compound Name | 1-(3,3-difluorocyclohexyl)-4-(4-prop-1-enylphenyl)benzene |
|---|---|
| PubChem CID | 151822303 |
| Molecular Formula | C21H22F2 |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-(3,3-difluorocyclohexyl)-4-(4-prop-1-enylphenyl)benzene |
| SMILES | CC=Cc1ccc(-c2ccc(C3CCCC(F)(F)C3)cc2)cc1 |
| InChI | InChI=1S/C21H22F2/c1-2-4-16-6-8-17(9-7-16)18-10-12-19(13-11-18)20-5-3-14-21(22,23)15-20/h2,4,6-13,20H,3,5,14-15H2,1H3 |
| InChIKey | SCWRERYEUUGWMV-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |