C32H31P — CID 170248391
[5-[4-[3-ethyl-4-[2-(4-methylphenyl)ethynyl]phenyl]-2-methylphenyl]-2,3-dimethylphenyl]phosphane (PubChem CID 170248391) has the molecular formula C32H31P and a molecular weight of 446.57 g/mol. Its IUPAC name is [5-[4-[3-ethyl-4-[2-(4-methylphenyl)ethynyl]phenyl]-2-methylphenyl]-2,3-dimethylphenyl]phosphane.
| Compound Name | [5-[4-[3-ethyl-4-[2-(4-methylphenyl)ethynyl]phenyl]-2-methylphenyl]-2,3-dimethylphenyl]phosphane |
|---|---|
| PubChem CID | 170248391 |
| Molecular Formula | C32H31P |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | [5-[4-[3-ethyl-4-[2-(4-methylphenyl)ethynyl]phenyl]-2-methylphenyl]-2,3-dimethylphenyl]phosphane |
| SMILES | CCc1cc(-c2ccc(-c3cc(C)c(C)c(P)c3)c(C)c2)ccc1C#Cc1ccc(C)cc1 |
| InChI | InChI=1S/C32H31P/c1-6-26-19-29(14-13-27(26)12-11-25-9-7-21(2)8-10-25)28-15-16-31(23(4)18-28)30-17-22(3)24(5)32(33)20-30/h7-10,13-20H,6,33H2,1-5H3 |
| InChIKey | KCQYYHHPIVSXPU-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|