C33H26F6O — CID 123849859
5-[4-[4-[2-(4-butylphenyl)ethynyl]-3-ethylphenyl]-2-fluorophenyl]-1,3-difluoro-2-(trifluoromethoxy)benzene (PubChem CID 123849859) has the molecular formula C33H26F6O and a molecular weight of 552.56 g/mol. Its IUPAC name is 5-[4-[4-[2-(4-butylphenyl)ethynyl]-3-ethylphenyl]-2-fluorophenyl]-1,3-difluoro-2-(trifluoromethoxy)benzene.
| Compound Name | 5-[4-[4-[2-(4-butylphenyl)ethynyl]-3-ethylphenyl]-2-fluorophenyl]-1,3-difluoro-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 123849859 |
| Molecular Formula | C33H26F6O |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 5-[4-[4-[2-(4-butylphenyl)ethynyl]-3-ethylphenyl]-2-fluorophenyl]-1,3-difluoro-2-(trifluoromethoxy)benzene |
| SMILES | CCCCc1ccc(C#Cc2ccc(-c3ccc(-c4cc(F)c(OC(F)(F)F)c(F)c4)c(F)c3)cc2CC)cc1 |
| InChI | InChI=1S/C33H26F6O/c1-3-5-6-21-7-9-22(10-8-21)11-12-24-13-14-25(17-23(24)4-2)26-15-16-28(29(34)18-26)27-19-30(35)32(31(36)20-27)40-33(37,38)39/h7-10,13-20H,3-6H2,1-2H3 |
| InChIKey | XVGMTKDEFKCPSH-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|