C30H32F2 — CID 102430609
1,3-difluoro-2-[2-[4-[4-[(2S)-2-methylbutyl]phenyl]phenyl]ethynyl]-5-pentylbenzene (PubChem CID 102430609) has the molecular formula C30H32F2 and a molecular weight of 430.58 g/mol. Its IUPAC name is 1,3-difluoro-2-[2-[4-[4-[(2S)-2-methylbutyl]phenyl]phenyl]ethynyl]-5-pentylbenzene.
| Compound Name | 1,3-difluoro-2-[2-[4-[4-[(2S)-2-methylbutyl]phenyl]phenyl]ethynyl]-5-pentylbenzene |
|---|---|
| PubChem CID | 102430609 |
| Molecular Formula | C30H32F2 |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 1,3-difluoro-2-[2-[4-[4-[(2S)-2-methylbutyl]phenyl]phenyl]ethynyl]-5-pentylbenzene |
| SMILES | CCCCCc1cc(F)c(C#Cc2ccc(-c3ccc(C[C@@H](C)CC)cc3)cc2)c(F)c1 |
| InChI | InChI=1S/C30H32F2/c1-4-6-7-8-25-20-29(31)28(30(32)21-25)18-13-23-9-14-26(15-10-23)27-16-11-24(12-17-27)19-22(3)5-2/h9-12,14-17,20-22H,4-8,19H2,1-3H3/t22-/m0/s1 |
| InChIKey | DWDVOETXOQISPJ-QFIPXVFZSA-N |
| XLogP | 8.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|