C14H18BrClO — CID 12870627
2-bromo-6-(4-chlorophenyl)-5,5-dimethylhexan-3-one (PubChem CID 12870627) has the molecular formula C14H18BrClO and a molecular weight of 317.65 g/mol. Its IUPAC name is 2-bromo-6-(4-chlorophenyl)-5,5-dimethylhexan-3-one.
| Compound Name | 2-bromo-6-(4-chlorophenyl)-5,5-dimethylhexan-3-one |
|---|---|
| PubChem CID | 12870627 |
| Molecular Formula | C14H18BrClO |
| Molecular Weight | 317.65 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2-bromo-6-(4-chlorophenyl)-5,5-dimethylhexan-3-one |
| SMILES | CC(Br)C(=O)CC(C)(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18BrClO/c1-10(15)13(17)9-14(2,3)8-11-4-6-12(16)7-5-11/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | SFGPWTWEMDXHKS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|