C25H26NO4P — CID 98518869
methyl (3R,4S)-3-methyl-4-nitro-2-(triphenyl-λ5-phosphanylidene)pentanoate (PubChem CID 98518869) has the molecular formula C25H26NO4P and a molecular weight of 435.46 g/mol. Its IUPAC name is methyl (3R,4S)-3-methyl-4-nitro-2-(triphenyl-λ5-phosphanylidene)pentanoate.
| Compound Name | methyl (3R,4S)-3-methyl-4-nitro-2-(triphenyl-λ5-phosphanylidene)pentanoate |
|---|---|
| PubChem CID | 98518869 |
| Molecular Formula | C25H26NO4P |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | methyl (3R,4S)-3-methyl-4-nitro-2-(triphenyl-λ5-phosphanylidene)pentanoate |
| SMILES | COC(=O)C([C@H](C)[C@H](C)[N+](=O)[O-])=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26NO4P/c1-19(20(2)26(28)29)24(25(27)30-3)31(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-20H,1-3H3/t19-,20+/m1/s1 |
| InChIKey | AGXZKQDOMNQNTO-UXHICEINSA-N |
| XLogP | 3.63 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|