C32H31O5P — CID 132560914
dimethyl 2-(3-hydroxy-2,6-dimethylphenyl)-3-(triphenyl-λ5-phosphanylidene)butanedioate (PubChem CID 132560914) has the molecular formula C32H31O5P and a molecular weight of 526.57 g/mol. Its IUPAC name is dimethyl 2-(3-hydroxy-2,6-dimethylphenyl)-3-(triphenyl-λ5-phosphanylidene)butanedioate.
| Compound Name | dimethyl 2-(3-hydroxy-2,6-dimethylphenyl)-3-(triphenyl-λ5-phosphanylidene)butanedioate |
|---|---|
| PubChem CID | 132560914 |
| Molecular Formula | C32H31O5P |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | dimethyl 2-(3-hydroxy-2,6-dimethylphenyl)-3-(triphenyl-λ5-phosphanylidene)butanedioate |
| SMILES | COC(=O)C(C(C(=O)OC)c1c(C)ccc(O)c1C)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H31O5P/c1-22-20-21-27(33)23(2)28(22)29(31(34)36-3)30(32(35)37-4)38(24-14-8-5-9-15-24,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-21,29,33H,1-4H3 |
| InChIKey | WMBNURXZXTYILL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|