C34H29N2O7P — CID 12996557
dimethyl 2-[acetyl-(1,3-dioxoisoindol-2-yl)amino]-3-(triphenyl-lambda5-phosphanylidene)butanedioate (PubChem CID 12996557) has the molecular formula C34H29N2O7P and a molecular weight of 608.59 g/mol. Its IUPAC name is dimethyl 2-[acetyl-(1,3-dioxoisoindol-2-yl)amino]-3-(triphenyl-lambda5-phosphanylidene)butanedioate.
| Compound Name | dimethyl 2-[acetyl-(1,3-dioxoisoindol-2-yl)amino]-3-(triphenyl-lambda5-phosphanylidene)butanedioate |
|---|---|
| PubChem CID | 12996557 |
| Molecular Formula | C34H29N2O7P |
| Molecular Weight | 608.59 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | dimethyl 2-[acetyl-(1,3-dioxoisoindol-2-yl)amino]-3-(triphenyl-lambda5-phosphanylidene)butanedioate |
| SMILES | COC(=O)C(C(C(=O)OC)N(C(C)=O)N1C(=O)c2ccccc2C1=O)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H29N2O7P/c1-23(37)35(36-31(38)27-21-13-14-22-28(27)32(36)39)29(33(40)42-2)30(34(41)43-3)44(24-15-7-4-8-16-24,25-17-9-5-10-18-25)26-19-11-6-12-20-26/h4-22,29H,1-3H3 |
| InChIKey | GCZSDRDKLHFZFZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|