C19H19NO8 — CID 10992758
trimethyl (Z)-4-(1,3-dioxoisoindol-2-yl)-3-methylbut-3-ene-1,1,4-tricarboxylate (PubChem CID 10992758) has the molecular formula C19H19NO8 and a molecular weight of 389.36 g/mol. Its IUPAC name is trimethyl (Z)-4-(1,3-dioxoisoindol-2-yl)-3-methylbut-3-ene-1,1,4-tricarboxylate.
| Compound Name | trimethyl (Z)-4-(1,3-dioxoisoindol-2-yl)-3-methylbut-3-ene-1,1,4-tricarboxylate |
|---|---|
| PubChem CID | 10992758 |
| Molecular Formula | C19H19NO8 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | trimethyl (Z)-4-(1,3-dioxoisoindol-2-yl)-3-methylbut-3-ene-1,1,4-tricarboxylate |
| SMILES | COC(=O)/C(=C(\C)CC(C(=O)OC)C(=O)OC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H19NO8/c1-10(9-13(17(23)26-2)18(24)27-3)14(19(25)28-4)20-15(21)11-7-5-6-8-12(11)16(20)22/h5-8,13H,9H2,1-4H3/b14-10- |
| InChIKey | AICPHZQUQWGNIJ-UVTDQMKNSA-N |
| XLogP | 1.08 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|