C39H35N2O6P — CID 25179818
dimethyl 2-[benzoyl-[(E)-(2-methoxyphenyl)methylideneamino]amino]-3-(triphenyl-λ5-phosphanylidene)butanedioate (PubChem CID 25179818) has the molecular formula C39H35N2O6P and a molecular weight of 658.69 g/mol. Its IUPAC name is dimethyl 2-[benzoyl-[(E)-(2-methoxyphenyl)methylideneamino]amino]-3-(triphenyl-λ5-phosphanylidene)butanedioate.
| Compound Name | dimethyl 2-[benzoyl-[(E)-(2-methoxyphenyl)methylideneamino]amino]-3-(triphenyl-λ5-phosphanylidene)butanedioate |
|---|---|
| PubChem CID | 25179818 |
| Molecular Formula | C39H35N2O6P |
| Molecular Weight | 658.69 g/mol |
| Exact Mass | 658.22 |
| IUPAC Name | dimethyl 2-[benzoyl-[(E)-(2-methoxyphenyl)methylideneamino]amino]-3-(triphenyl-λ5-phosphanylidene)butanedioate |
| SMILES | COC(=O)C(C(C(=O)OC)N(/N=C/c1ccccc1OC)C(=O)c1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H35N2O6P/c1-45-34-27-17-16-20-30(34)28-40-41(37(42)29-18-8-4-9-19-29)35(38(43)46-2)36(39(44)47-3)48(31-21-10-5-11-22-31,32-23-12-6-13-24-32)33-25-14-7-15-26-33/h4-28,35H,1-3H3/b40-28+ |
| InChIKey | DYGGXFZNZKKVPS-JFXHSDHMSA-N |
| XLogP | 5.05 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.69 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|