C26H24N2O10 — CID 177404478
dimethyl (Z)-2-[benzoyl-[(E)-[2-[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]oxyphenyl]methylideneamino]amino]but-2-enedioate (PubChem CID 177404478) has the molecular formula C26H24N2O10 and a molecular weight of 524.48 g/mol. Its IUPAC name is dimethyl (Z)-2-[benzoyl-[(E)-[2-[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]oxyphenyl]methylideneamino]amino]but-2-enedioate.
| Compound Name | dimethyl (Z)-2-[benzoyl-[(E)-[2-[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]oxyphenyl]methylideneamino]amino]but-2-enedioate |
|---|---|
| PubChem CID | 177404478 |
| Molecular Formula | C26H24N2O10 |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | dimethyl (Z)-2-[benzoyl-[(E)-[2-[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]oxyphenyl]methylideneamino]amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(\Oc1ccccc1/C=N/N(C(=O)c1ccccc1)/C(=C\C(=O)OC)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C26H24N2O10/c1-34-22(29)14-19(25(32)36-3)28(24(31)17-10-6-5-7-11-17)27-16-18-12-8-9-13-20(18)38-21(26(33)37-4)15-23(30)35-2/h5-16H,1-4H3/b19-14-,21-15-,27-16+ |
| InChIKey | BQUDCIWISHMZML-GBATVBDBSA-N |
| XLogP | 2.00 |
| TPSA | 147.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|