C30H26N2O10 — CID 46918715
dimethyl (Z)-2-[benzoyl-[(E)-[2-[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]oxynaphthalen-1-yl]methylideneamino]amino]but-2-enedioate (PubChem CID 46918715) has the molecular formula C30H26N2O10 and a molecular weight of 574.54 g/mol. Its IUPAC name is dimethyl (Z)-2-[benzoyl-[(E)-[2-[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]oxynaphthalen-1-yl]methylideneamino]amino]but-2-enedioate.
| Compound Name | dimethyl (Z)-2-[benzoyl-[(E)-[2-[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]oxynaphthalen-1-yl]methylideneamino]amino]but-2-enedioate |
|---|---|
| PubChem CID | 46918715 |
| Molecular Formula | C30H26N2O10 |
| Molecular Weight | 574.54 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | dimethyl (Z)-2-[benzoyl-[(E)-[2-[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]oxynaphthalen-1-yl]methylideneamino]amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/C(=O)OC)N(/N=C/c1c(O/C(=C/C(=O)OC)C(=O)OC)ccc2ccccc12)C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H26N2O10/c1-38-26(33)16-23(29(36)40-3)32(28(35)20-11-6-5-7-12-20)31-18-22-21-13-9-8-10-19(21)14-15-24(22)42-25(30(37)41-4)17-27(34)39-2/h5-18H,1-4H3/b23-16-,25-17+,31-18+ |
| InChIKey | NLABWXNIMHQDKJ-STWMIRFZSA-N |
| XLogP | 3.15 |
| TPSA | 147.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|