About [1-[(Z)-(phenylhydrazinylidene)methyl]naphthalen-2-yl] 4-chlorobenzoate
[1-[(Z)-(phenylhydrazinylidene)methyl]naphthalen-2-yl] 4-chlorobenzoate (PubChem CID 6031687) has the molecular formula C24H17ClN2O2
and a molecular weight of 400.87 g/mol. Its IUPAC name is [1-[(Z)-(phenylhydrazinylidene)methyl]naphthalen-2-yl] 4-chlorobenzoate.
Molecular Properties
| Compound Name | [1-[(Z)-(phenylhydrazinylidene)methyl]naphthalen-2-yl] 4-chlorobenzoate |
| PubChem CID | 6031687 |
| Molecular Formula | C24H17ClN2O2 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | [1-[(Z)-(phenylhydrazinylidene)methyl]naphthalen-2-yl] 4-chlorobenzoate |
| SMILES | O=C(Oc1ccc2ccccc2c1/C=N\Nc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H17ClN2O2/c25-19-13-10-18(11-14-19)24(28)29-23-15-12-17-6-4-5-9-21(17)22(23)16-26-27-20-7-2-1-3-8-20/h1-16,27H/b26-16- |
| InChIKey | FNRRSEPRFHKEJF-QQXSKIMKSA-N |
| XLogP | 6.16 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [1-[(Z)-(phenylhydrazinylidene)methyl]naphthalen-2-yl] 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(Z)-(phenylhydrazinylidene)methyl]naphthalen-2-yl] 4-chlorobenzoate?
The IUPAC name of [1-[(Z)-(phenylhydrazinylidene)methyl]naphthalen-2-yl] 4-chlorobenzoate (CID 6031687) is [1-[(Z)-(phenylhydrazinylidene)methyl]naphthalen-2-yl] 4-chlorobenzoate.
What is the SMILES notation for [1-[(Z)-(phenylhydrazinylidene)methyl]naphthalen-2-yl] 4-chlorobenzoate?
The canonical SMILES for [1-[(Z)-(phenylhydrazinylidene)methyl]naphthalen-2-yl] 4-chlorobenzoate is O=C(Oc1ccc2ccccc2c1/C=N\Nc1ccccc1)c1ccc(Cl)cc1.
What is the InChIKey of [1-[(Z)-(phenylhydrazinylidene)methyl]naphthalen-2-yl] 4-chlorobenzoate?
The InChIKey is FNRRSEPRFHKEJF-QQXSKIMKSA-N. The full InChI is InChI=1S/C24H17ClN2O2/c25-19-13-10-18(11-14-19)24(28)29-23-15-12-17-6-4-5-9-21(17)22(23)16-26-27-20-7-2-1-3-8-20/h1-16,27H/b26-16-.
What are the key properties of [1-[(Z)-(phenylhydrazinylidene)methyl]naphthalen-2-yl] 4-chlorobenzoate?
[1-[(Z)-(phenylhydrazinylidene)methyl]naphthalen-2-yl] 4-chlorobenzoate has a molecular weight of 400.87 g/mol, XLogP of 6.16, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(Z)-(phenylhydrazinylidene)methyl]naphthalen-2-yl] 4-chlorobenzoate is sourced from PubChem (CID 6031687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).