C33H24Cl2N2O6 — CID 3557249
[1-[[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate (PubChem CID 3557249) has the molecular formula C33H24Cl2N2O6 and a molecular weight of 615.47 g/mol. Its IUPAC name is [1-[[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate.
| Compound Name | [1-[[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 3557249 |
| Molecular Formula | C33H24Cl2N2O6 |
| Molecular Weight | 615.47 g/mol |
| Exact Mass | 614.10 |
| IUPAC Name | [1-[[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3ccccc3c2C=NNC(=O)C(Oc2ccc(Cl)cc2)Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C33H24Cl2N2O6/c1-40-25-13-6-22(7-14-25)32(39)43-30-19-8-21-4-2-3-5-28(21)29(30)20-36-37-31(38)33(41-26-15-9-23(34)10-16-26)42-27-17-11-24(35)12-18-27/h2-20,33H,1H3,(H,37,38) |
| InChIKey | TYUKWCIORXHUQR-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.47 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|