C32H29BrNO5P — CID 11606938
dimethyl 2-(N-acetyl-4-bromoanilino)-3-(triphenyl-λ5-phosphanylidene)butanedioate (PubChem CID 11606938) has the molecular formula C32H29BrNO5P and a molecular weight of 618.46 g/mol. Its IUPAC name is dimethyl 2-(N-acetyl-4-bromoanilino)-3-(triphenyl-λ5-phosphanylidene)butanedioate.
| Compound Name | dimethyl 2-(N-acetyl-4-bromoanilino)-3-(triphenyl-λ5-phosphanylidene)butanedioate |
|---|---|
| PubChem CID | 11606938 |
| Molecular Formula | C32H29BrNO5P |
| Molecular Weight | 618.46 g/mol |
| Exact Mass | 617.10 |
| IUPAC Name | dimethyl 2-(N-acetyl-4-bromoanilino)-3-(triphenyl-λ5-phosphanylidene)butanedioate |
| SMILES | COC(=O)C(C(C(=O)OC)N(C(C)=O)c1ccc(Br)cc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H29BrNO5P/c1-23(35)34(25-21-19-24(33)20-22-25)29(31(36)38-2)30(32(37)39-3)40(26-13-7-4-8-14-26,27-15-9-5-10-16-27)28-17-11-6-12-18-28/h4-22,29H,1-3H3 |
| InChIKey | BBWCTICVWVRVAE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|