C39H31N3O9P+ — CID 11320081
[(Z)-3-[(1,3-dioxoisoindol-2-yl)-(4-nitrobenzoyl)amino]-1-hydroxy-1,4-dimethoxy-4-oxobut-1-en-2-yl]-triphenylphosphanium (PubChem CID 11320081) has the molecular formula C39H31N3O9P+ and a molecular weight of 716.66 g/mol. Its IUPAC name is [(Z)-3-[(1,3-dioxoisoindol-2-yl)-(4-nitrobenzoyl)amino]-1-hydroxy-1,4-dimethoxy-4-oxobut-1-en-2-yl]-triphenylphosphanium.
| Compound Name | [(Z)-3-[(1,3-dioxoisoindol-2-yl)-(4-nitrobenzoyl)amino]-1-hydroxy-1,4-dimethoxy-4-oxobut-1-en-2-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 11320081 |
| Molecular Formula | C39H31N3O9P+ |
| Molecular Weight | 716.66 g/mol |
| Exact Mass | 716.18 |
| IUPAC Name | [(Z)-3-[(1,3-dioxoisoindol-2-yl)-(4-nitrobenzoyl)amino]-1-hydroxy-1,4-dimethoxy-4-oxobut-1-en-2-yl]-triphenylphosphanium |
| SMILES | COC(=O)C(/C(=C(\O)OC)[P+](c1ccccc1)(c1ccccc1)c1ccccc1)N(C(=O)c1ccc([N+](=O)[O-])cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C39H30N3O9P/c1-50-38(46)33(40(35(43)26-22-24-27(25-23-26)42(48)49)41-36(44)31-20-12-13-21-32(31)37(41)45)34(39(47)51-2)52(28-14-6-3-7-15-28,29-16-8-4-9-17-29)30-18-10-5-11-19-30/h3-25,33H,1-2H3/p+1/b39-34- |
| InChIKey | CELAMNBLSNCCPL-RSHGFABKSA-O |
| XLogP | 5.16 |
| TPSA | 156.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|