C14H22NO5P — CID 141034258
2-diethoxyphosphoryl-N-[(2-methoxyphenyl)methyl]acetamide (PubChem CID 141034258) has the molecular formula C14H22NO5P and a molecular weight of 315.31 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-N-[(2-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-diethoxyphosphoryl-N-[(2-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 141034258 |
| Molecular Formula | C14H22NO5P |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-diethoxyphosphoryl-N-[(2-methoxyphenyl)methyl]acetamide |
| SMILES | CCOP(=O)(CC(=O)NCc1ccccc1OC)OCC |
| InChI | InChI=1S/C14H22NO5P/c1-4-19-21(17,20-5-2)11-14(16)15-10-12-8-6-7-9-13(12)18-3/h6-9H,4-5,10-11H2,1-3H3,(H,15,16) |
| InChIKey | WCDZALZTZVKBNP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|