C29H25N2O3P — CID 15259056
methyl 4-anilino-3-imino-4-oxo-2-(triphenyl-lambda5-phosphanylidene)butanoate (PubChem CID 15259056) has the molecular formula C29H25N2O3P and a molecular weight of 480.50 g/mol. Its IUPAC name is methyl 4-anilino-3-imino-4-oxo-2-(triphenyl-lambda5-phosphanylidene)butanoate.
| Compound Name | methyl 4-anilino-3-imino-4-oxo-2-(triphenyl-lambda5-phosphanylidene)butanoate |
|---|---|
| PubChem CID | 15259056 |
| Molecular Formula | C29H25N2O3P |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | methyl 4-anilino-3-imino-4-oxo-2-(triphenyl-lambda5-phosphanylidene)butanoate |
| SMILES | [H]/N=C(\C(=O)Nc1ccccc1)C(C(=O)OC)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H25N2O3P/c1-34-29(33)27(26(30)28(32)31-22-14-6-2-7-15-22)35(23-16-8-3-9-17-23,24-18-10-4-11-19-24)25-20-12-5-13-21-25/h2-21,30H,1H3,(H,31,32)/b30-26- |
| InChIKey | XTZPQFXQDOJPIN-BXVZCJGGSA-N |
| XLogP | 3.98 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|