C31H28NO4P — CID 13431000
methyl 6-anilino-4,6-dioxo-5-(triphenyl-λ5-phosphanylidene)hexanoate (PubChem CID 13431000) has the molecular formula C31H28NO4P and a molecular weight of 509.54 g/mol. Its IUPAC name is methyl 6-anilino-4,6-dioxo-5-(triphenyl-λ5-phosphanylidene)hexanoate.
| Compound Name | methyl 6-anilino-4,6-dioxo-5-(triphenyl-λ5-phosphanylidene)hexanoate |
|---|---|
| PubChem CID | 13431000 |
| Molecular Formula | C31H28NO4P |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | methyl 6-anilino-4,6-dioxo-5-(triphenyl-λ5-phosphanylidene)hexanoate |
| SMILES | COC(=O)CCC(=O)C(C(=O)Nc1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H28NO4P/c1-36-29(34)23-22-28(33)30(31(35)32-24-14-6-2-7-15-24)37(25-16-8-3-9-17-25,26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-21H,22-23H2,1H3,(H,32,35) |
| InChIKey | BBQDSNXWZROJIS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|