C40H33O3P — CID 100950017
methyl 3-[(15R,16S)-16-ethenyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]-3-oxo-2-(triphenyl-λ5-phosphanylidene)propanoate (PubChem CID 100950017) has the molecular formula C40H33O3P and a molecular weight of 592.68 g/mol. Its IUPAC name is methyl 3-[(15R,16S)-16-ethenyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]-3-oxo-2-(triphenyl-λ5-phosphanylidene)propanoate.
| Compound Name | methyl 3-[(15R,16S)-16-ethenyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]-3-oxo-2-(triphenyl-λ5-phosphanylidene)propanoate |
|---|---|
| PubChem CID | 100950017 |
| Molecular Formula | C40H33O3P |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | methyl 3-[(15R,16S)-16-ethenyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]-3-oxo-2-(triphenyl-λ5-phosphanylidene)propanoate |
| SMILES | C=C[C@H]1C2c3ccccc3C(c3ccccc32)[C@@H]1C(=O)C(C(=O)OC)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H33O3P/c1-3-30-35-31-23-13-15-25-33(31)36(34-26-16-14-24-32(34)35)37(30)38(41)39(40(42)43-2)44(27-17-7-4-8-18-27,28-19-9-5-10-20-28)29-21-11-6-12-22-29/h3-26,30,35-37H,1H2,2H3/t30-,35?,36?,37+/m0/s1 |
| InChIKey | YVONDNCUVBANJA-IEADSHMMSA-N |
| XLogP | 6.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|