About 2-(chloromethyl)prop-2-enoic acid;methyl 2-benzylprop-2-enoate
2-(chloromethyl)prop-2-enoic acid;methyl 2-benzylprop-2-enoate (PubChem CID 175543990) has the molecular formula C15H17ClO4
and a molecular weight of 296.75 g/mol. Its IUPAC name is 2-(chloromethyl)prop-2-enoic acid;methyl 2-benzylprop-2-enoate.
Molecular Properties
| Compound Name | 2-(chloromethyl)prop-2-enoic acid;methyl 2-benzylprop-2-enoate |
| PubChem CID | 175543990 |
| Molecular Formula | C15H17ClO4 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-(chloromethyl)prop-2-enoic acid;methyl 2-benzylprop-2-enoate |
| SMILES | C=C(CCl)C(=O)O.C=C(Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C11H12O2.C4H5ClO2/c1-9(11(12)13-2)8-10-6-4-3-5-7-10;1-3(2-5)4(6)7/h3-7H,1,8H2,2H3;1-2H2,(H,6,7) |
| InChIKey | SYJKOBBZWXJXDZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)prop-2-enoic acid;methyl 2-benzylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)prop-2-enoic acid;methyl 2-benzylprop-2-enoate?
The IUPAC name of 2-(chloromethyl)prop-2-enoic acid;methyl 2-benzylprop-2-enoate (CID 175543990) is 2-(chloromethyl)prop-2-enoic acid;methyl 2-benzylprop-2-enoate.
What is the SMILES notation for 2-(chloromethyl)prop-2-enoic acid;methyl 2-benzylprop-2-enoate?
The canonical SMILES for 2-(chloromethyl)prop-2-enoic acid;methyl 2-benzylprop-2-enoate is C=C(CCl)C(=O)O.C=C(Cc1ccccc1)C(=O)OC.
What is the InChIKey of 2-(chloromethyl)prop-2-enoic acid;methyl 2-benzylprop-2-enoate?
The InChIKey is SYJKOBBZWXJXDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2.C4H5ClO2/c1-9(11(12)13-2)8-10-6-4-3-5-7-10;1-3(2-5)4(6)7/h3-7H,1,8H2,2H3;1-2H2,(H,6,7).
What are the key properties of 2-(chloromethyl)prop-2-enoic acid;methyl 2-benzylprop-2-enoate?
2-(chloromethyl)prop-2-enoic acid;methyl 2-benzylprop-2-enoate has a molecular weight of 296.75 g/mol, XLogP of 2.82, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)prop-2-enoic acid;methyl 2-benzylprop-2-enoate is sourced from PubChem (CID 175543990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).