About 2-ethylhexyl 2-methylprop-2-enoate;methyl 2-benzylprop-2-enoate
2-ethylhexyl 2-methylprop-2-enoate;methyl 2-benzylprop-2-enoate (PubChem CID 174900892) has the molecular formula C23H34O4
and a molecular weight of 374.52 g/mol. Its IUPAC name is 2-ethylhexyl 2-methylprop-2-enoate;methyl 2-benzylprop-2-enoate.
Molecular Properties
| Compound Name | 2-ethylhexyl 2-methylprop-2-enoate;methyl 2-benzylprop-2-enoate |
| PubChem CID | 174900892 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 2-ethylhexyl 2-methylprop-2-enoate;methyl 2-benzylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CC)CCCC.C=C(Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C12H22O2.C11H12O2/c1-5-7-8-11(6-2)9-14-12(13)10(3)4;1-9(11(12)13-2)8-10-6-4-3-5-7-10/h11H,3,5-9H2,1-2,4H3;3-7H,1,8H2,2H3 |
| InChIKey | CROAENHDNOSUGM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexyl 2-methylprop-2-enoate;methyl 2-benzylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl 2-methylprop-2-enoate;methyl 2-benzylprop-2-enoate?
The IUPAC name of 2-ethylhexyl 2-methylprop-2-enoate;methyl 2-benzylprop-2-enoate (CID 174900892) is 2-ethylhexyl 2-methylprop-2-enoate;methyl 2-benzylprop-2-enoate.
What is the SMILES notation for 2-ethylhexyl 2-methylprop-2-enoate;methyl 2-benzylprop-2-enoate?
The canonical SMILES for 2-ethylhexyl 2-methylprop-2-enoate;methyl 2-benzylprop-2-enoate is C=C(C)C(=O)OCC(CC)CCCC.C=C(Cc1ccccc1)C(=O)OC.
What is the InChIKey of 2-ethylhexyl 2-methylprop-2-enoate;methyl 2-benzylprop-2-enoate?
The InChIKey is CROAENHDNOSUGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2.C11H12O2/c1-5-7-8-11(6-2)9-14-12(13)10(3)4;1-9(11(12)13-2)8-10-6-4-3-5-7-10/h11H,3,5-9H2,1-2,4H3;3-7H,1,8H2,2H3.
What are the key properties of 2-ethylhexyl 2-methylprop-2-enoate;methyl 2-benzylprop-2-enoate?
2-ethylhexyl 2-methylprop-2-enoate;methyl 2-benzylprop-2-enoate has a molecular weight of 374.52 g/mol, XLogP of 5.28, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 2-methylprop-2-enoate;methyl 2-benzylprop-2-enoate is sourced from PubChem (CID 174900892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).