C12H15NO — CID 67100318
2-benzyl-N,N-dimethylprop-2-enamide (PubChem CID 67100318) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-benzyl-N,N-dimethylprop-2-enamide.
| Compound Name | 2-benzyl-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 67100318 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-benzyl-N,N-dimethylprop-2-enamide |
| SMILES | C=C(Cc1ccccc1)C(=O)N(C)C |
| InChI | InChI=1S/C12H15NO/c1-10(12(14)13(2)3)9-11-7-5-4-6-8-11/h4-8H,1,9H2,2-3H3 |
| InChIKey | GCUORMCOHRCWHD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|