C20H18O8 — CID 141194460
(2S,3S)-2,3-dihydroxy-2,3-bis(2-phenylacetyl)butanedioic acid (PubChem CID 141194460) has the molecular formula C20H18O8 and a molecular weight of 386.36 g/mol. Its IUPAC name is (2S,3S)-2,3-dihydroxy-2,3-bis(2-phenylacetyl)butanedioic acid.
| Compound Name | (2S,3S)-2,3-dihydroxy-2,3-bis(2-phenylacetyl)butanedioic acid |
|---|---|
| PubChem CID | 141194460 |
| Molecular Formula | C20H18O8 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (2S,3S)-2,3-dihydroxy-2,3-bis(2-phenylacetyl)butanedioic acid |
| SMILES | O=C(O)[C@@](O)(C(=O)Cc1ccccc1)[C@@](O)(C(=O)O)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H18O8/c21-15(11-13-7-3-1-4-8-13)19(27,17(23)24)20(28,18(25)26)16(22)12-14-9-5-2-6-10-14/h1-10,27-28H,11-12H2,(H,23,24)(H,25,26)/t19-,20-/m0/s1 |
| InChIKey | TVOUYCKMVQUPOR-PMACEKPBSA-N |
| XLogP | 0.24 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|