C19H24O — CID 145499398
(3Z)-4-ethenyl-8-(3-ethylphenyl)-6-methylideneocta-1,3-dien-2-ol (PubChem CID 145499398) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is (3Z)-4-ethenyl-8-(3-ethylphenyl)-6-methylideneocta-1,3-dien-2-ol.
| Compound Name | (3Z)-4-ethenyl-8-(3-ethylphenyl)-6-methylideneocta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 145499398 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (3Z)-4-ethenyl-8-(3-ethylphenyl)-6-methylideneocta-1,3-dien-2-ol |
| SMILES | C=C/C(=C\C(=C)O)CC(=C)CCc1cccc(CC)c1 |
| InChI | InChI=1S/C19H24O/c1-5-17-8-7-9-19(14-17)11-10-15(3)12-18(6-2)13-16(4)20/h6-9,13-14,20H,2-5,10-12H2,1H3/b18-13+ |
| InChIKey | GBVHBSUJXYKAGX-QGOAFFKASA-N |
| XLogP | 5.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|