C9H17NS — CID 143022527
(2Z)-1-[methyl(propyl)amino]penta-2,4-diene-2-thiol (PubChem CID 143022527) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is (2Z)-1-[methyl(propyl)amino]penta-2,4-diene-2-thiol.
| Compound Name | (2Z)-1-[methyl(propyl)amino]penta-2,4-diene-2-thiol |
|---|---|
| PubChem CID | 143022527 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | (2Z)-1-[methyl(propyl)amino]penta-2,4-diene-2-thiol |
| SMILES | C=C/C=C(\S)CN(C)CCC |
| InChI | InChI=1S/C9H17NS/c1-4-6-9(11)8-10(3)7-5-2/h4,6,11H,1,5,7-8H2,2-3H3/b9-6- |
| InChIKey | RWHDUZVRNSCTFA-TWGQIWQCSA-N |
| XLogP | 2.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|