About ethene;N-ethyl-N-methylpropan-1-amine
ethene;N-ethyl-N-methylpropan-1-amine (PubChem CID 153352940) has the molecular formula C8H19N
and a molecular weight of 129.25 g/mol. Its IUPAC name is ethene;N-ethyl-N-methylpropan-1-amine.
Molecular Properties
| Compound Name | ethene;N-ethyl-N-methylpropan-1-amine |
| PubChem CID | 153352940 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | ethene;N-ethyl-N-methylpropan-1-amine |
| SMILES | C=C.CCCN(C)CC |
| InChI | InChI=1S/C6H15N.C2H4/c1-4-6-7(3)5-2;1-2/h4-6H2,1-3H3;1-2H2 |
| InChIKey | FKYUDIANASEIDY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;N-ethyl-N-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;N-ethyl-N-methylpropan-1-amine?
The IUPAC name of ethene;N-ethyl-N-methylpropan-1-amine (CID 153352940) is ethene;N-ethyl-N-methylpropan-1-amine.
What is the SMILES notation for ethene;N-ethyl-N-methylpropan-1-amine?
The canonical SMILES for ethene;N-ethyl-N-methylpropan-1-amine is C=C.CCCN(C)CC.
What is the InChIKey of ethene;N-ethyl-N-methylpropan-1-amine?
The InChIKey is FKYUDIANASEIDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C2H4/c1-4-6-7(3)5-2;1-2/h4-6H2,1-3H3;1-2H2.
What are the key properties of ethene;N-ethyl-N-methylpropan-1-amine?
ethene;N-ethyl-N-methylpropan-1-amine has a molecular weight of 129.25 g/mol, XLogP of 2.15, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;N-ethyl-N-methylpropan-1-amine is sourced from PubChem (CID 153352940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).