C28H47NO3 — CID 142171339
ethane;[(4Z)-4-ethenyl-2-methylhepta-4,6-dien-2-yl] (2Z,4Z)-2-ethenyl-3-formylhexa-2,4-dienoate;N-methyl-N-propylpropan-1-amine (PubChem CID 142171339) has the molecular formula C28H47NO3 and a molecular weight of 445.69 g/mol. Its IUPAC name is ethane;[(4Z)-4-ethenyl-2-methylhepta-4,6-dien-2-yl] (2Z,4Z)-2-ethenyl-3-formylhexa-2,4-dienoate;N-methyl-N-propylpropan-1-amine.
| Compound Name | ethane;[(4Z)-4-ethenyl-2-methylhepta-4,6-dien-2-yl] (2Z,4Z)-2-ethenyl-3-formylhexa-2,4-dienoate;N-methyl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 142171339 |
| Molecular Formula | C28H47NO3 |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 445.36 |
| IUPAC Name | ethane;[(4Z)-4-ethenyl-2-methylhepta-4,6-dien-2-yl] (2Z,4Z)-2-ethenyl-3-formylhexa-2,4-dienoate;N-methyl-N-propylpropan-1-amine |
| SMILES | C=C/C=C(\C=C)CC(C)(C)OC(=O)/C(C=C)=C(C=O)/C=C\C.CC.CCCN(C)CCC |
| InChI | InChI=1S/C19H24O3.C7H17N.C2H6/c1-7-11-15(9-3)13-19(5,6)22-18(21)17(10-4)16(14-20)12-8-2;1-4-6-8(3)7-5-2;1-2/h7-12,14H,1,3-4,13H2,2,5-6H3;4-7H2,1-3H3;1-2H3/b12-8-,15-11+,17-16-;; |
| InChIKey | QWVJUCIQYKYWRV-JBHGOTIKSA-N |
| XLogP | 7.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|