C13H23NOS — CID 135193060
6-[[(3E,5E)-hepta-1,3,5-trien-3-yl]sulfanylamino]hexan-1-ol (PubChem CID 135193060) has the molecular formula C13H23NOS and a molecular weight of 241.40 g/mol. Its IUPAC name is 6-[[(3E,5E)-hepta-1,3,5-trien-3-yl]sulfanylamino]hexan-1-ol.
| Compound Name | 6-[[(3E,5E)-hepta-1,3,5-trien-3-yl]sulfanylamino]hexan-1-ol |
|---|---|
| PubChem CID | 135193060 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 6-[[(3E,5E)-hepta-1,3,5-trien-3-yl]sulfanylamino]hexan-1-ol |
| SMILES | C=C/C(=C\C=C\C)SNCCCCCCO |
| InChI | InChI=1S/C13H23NOS/c1-3-5-10-13(4-2)16-14-11-8-6-7-9-12-15/h3-5,10,14-15H,2,6-9,11-12H2,1H3/b5-3+,13-10+ |
| InChIKey | YLKSCWRBKZLHIB-KOUJJRQTSA-N |
| XLogP | 3.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|