C19H28O2 — CID 142864543
(2Z,4E)-7-methyl-3-[(3E,5Z)-3-[(Z)-prop-1-enyl]hepta-1,3,5-trienyl]octa-2,4-diene-1,5-diol (PubChem CID 142864543) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (2Z,4E)-7-methyl-3-[(3E,5Z)-3-[(Z)-prop-1-enyl]hepta-1,3,5-trienyl]octa-2,4-diene-1,5-diol.
| Compound Name | (2Z,4E)-7-methyl-3-[(3E,5Z)-3-[(Z)-prop-1-enyl]hepta-1,3,5-trienyl]octa-2,4-diene-1,5-diol |
|---|---|
| PubChem CID | 142864543 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (2Z,4E)-7-methyl-3-[(3E,5Z)-3-[(Z)-prop-1-enyl]hepta-1,3,5-trienyl]octa-2,4-diene-1,5-diol |
| SMILES | C/C=C\C=C(C=CC(=C/CO)/C=C(/O)CC(C)C)/C=C\C |
| InChI | InChI=1S/C19H28O2/c1-5-7-9-17(8-6-2)10-11-18(12-13-20)15-19(21)14-16(3)4/h5-12,15-16,20-21H,13-14H2,1-4H3/b7-5-,8-6-,11-10?,17-9+,18-12-,19-15+ |
| InChIKey | OEKHCZKQSCDJML-DGDDDSDTSA-N |
| XLogP | 5.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|