C11H16ClNO — CID 162732303
(2Z,3Z,5E)-5-chloro-N-methyl-2-propylidenehepta-3,5-dienamide (PubChem CID 162732303) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is (2Z,3Z,5E)-5-chloro-N-methyl-2-propylidenehepta-3,5-dienamide.
| Compound Name | (2Z,3Z,5E)-5-chloro-N-methyl-2-propylidenehepta-3,5-dienamide |
|---|---|
| PubChem CID | 162732303 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (2Z,3Z,5E)-5-chloro-N-methyl-2-propylidenehepta-3,5-dienamide |
| SMILES | C/C=C(Cl)\C=C/C(=C/CC)C(=O)NC |
| InChI | InChI=1S/C11H16ClNO/c1-4-6-9(11(14)13-3)7-8-10(12)5-2/h5-8H,4H2,1-3H3,(H,13,14)/b8-7-,9-6-,10-5+ |
| InChIKey | VLKHHLQYERPDQO-CEWXQRBCSA-N |
| XLogP | 2.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|