C13H18S — CID 164530728
ethane;2-[(3Z)-hexa-1,3,5-trien-2-yl]-5-methylthiophene (PubChem CID 164530728) has the molecular formula C13H18S and a molecular weight of 206.35 g/mol. Its IUPAC name is ethane;2-[(3Z)-hexa-1,3,5-trien-2-yl]-5-methylthiophene.
| Compound Name | ethane;2-[(3Z)-hexa-1,3,5-trien-2-yl]-5-methylthiophene |
|---|---|
| PubChem CID | 164530728 |
| Molecular Formula | C13H18S |
| Molecular Weight | 206.35 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | ethane;2-[(3Z)-hexa-1,3,5-trien-2-yl]-5-methylthiophene |
| SMILES | C=C/C=C\C(=C)c1ccc(C)s1.CC |
| InChI | InChI=1S/C11H12S.C2H6/c1-4-5-6-9(2)11-8-7-10(3)12-11;1-2/h4-8H,1-2H2,3H3;1-2H3/b6-5-; |
| InChIKey | DGXXQYDDRBFFED-YSMBQZINSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.35 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|