C7H6F2S — CID 15970252
2-[(E)-1,2-difluoroethenyl]-5-methylthiophene (PubChem CID 15970252) has the molecular formula C7H6F2S and a molecular weight of 160.19 g/mol. Its IUPAC name is 2-[(E)-1,2-difluoroethenyl]-5-methylthiophene.
| Compound Name | 2-[(E)-1,2-difluoroethenyl]-5-methylthiophene |
|---|---|
| PubChem CID | 15970252 |
| Molecular Formula | C7H6F2S |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | 2-[(E)-1,2-difluoroethenyl]-5-methylthiophene |
| SMILES | Cc1ccc(/C(F)=C\F)s1 |
| InChI | InChI=1S/C7H6F2S/c1-5-2-3-7(10-5)6(9)4-8/h2-4H,1H3/b6-4+ |
| InChIKey | SOTNGVMBINUWAR-GQCTYLIASA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |