C12H14S — CID 142216426
2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-5-methylthiophene (PubChem CID 142216426) has the molecular formula C12H14S and a molecular weight of 190.31 g/mol. Its IUPAC name is 2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-5-methylthiophene.
| Compound Name | 2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-5-methylthiophene |
|---|---|
| PubChem CID | 142216426 |
| Molecular Formula | C12H14S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-5-methylthiophene |
| SMILES | C=C/C=C\C=C(/C)c1ccc(C)s1 |
| InChI | InChI=1S/C12H14S/c1-4-5-6-7-10(2)12-9-8-11(3)13-12/h4-9H,1H2,2-3H3/b6-5-,10-7+ |
| InChIKey | LMJBPDXNIDULFF-ZZWPSLBBSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|