C9H10S2 — CID 142100877
(1Z)-1-(5-methylthiophen-2-yl)buta-1,3-diene-1-thiol (PubChem CID 142100877) has the molecular formula C9H10S2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (1Z)-1-(5-methylthiophen-2-yl)buta-1,3-diene-1-thiol.
| Compound Name | (1Z)-1-(5-methylthiophen-2-yl)buta-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 142100877 |
| Molecular Formula | C9H10S2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | (1Z)-1-(5-methylthiophen-2-yl)buta-1,3-diene-1-thiol |
| SMILES | C=C/C=C(\S)c1ccc(C)s1 |
| InChI | InChI=1S/C9H10S2/c1-3-4-8(10)9-6-5-7(2)11-9/h3-6,10H,1H2,2H3/b8-4- |
| InChIKey | UYYBGLWHMUGOHU-YWEYNIOJSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|