C15H17Br — CID 142006015
[(1E,3E)-1-bromo-3-[(Z)-prop-1-enyl]hexa-1,3-dien-2-yl]benzene (PubChem CID 142006015) has the molecular formula C15H17Br and a molecular weight of 277.21 g/mol. Its IUPAC name is [(1E,3E)-1-bromo-3-[(Z)-prop-1-enyl]hexa-1,3-dien-2-yl]benzene.
| Compound Name | [(1E,3E)-1-bromo-3-[(Z)-prop-1-enyl]hexa-1,3-dien-2-yl]benzene |
|---|---|
| PubChem CID | 142006015 |
| Molecular Formula | C15H17Br |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | [(1E,3E)-1-bromo-3-[(Z)-prop-1-enyl]hexa-1,3-dien-2-yl]benzene |
| SMILES | C/C=C\C(=C/CC)\C(=C/Br)c1ccccc1 |
| InChI | InChI=1S/C15H17Br/c1-3-8-13(9-4-2)15(12-16)14-10-6-5-7-11-14/h3,5-12H,4H2,1-2H3/b8-3-,13-9+,15-12+ |
| InChIKey | ATWAFHHFOFUKHR-GZNHKYGRSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|