C25H27BrN2 — CID 144892656
(Z,2E)-N'-[(E)-1-(3-bromophenyl)but-1-enyl]-2-ethylidene-N-(1-phenylethylidene)pent-3-enimidamide (PubChem CID 144892656) has the molecular formula C25H27BrN2 and a molecular weight of 435.41 g/mol. Its IUPAC name is (Z,2E)-N'-[(E)-1-(3-bromophenyl)but-1-enyl]-2-ethylidene-N-(1-phenylethylidene)pent-3-enimidamide.
| Compound Name | (Z,2E)-N'-[(E)-1-(3-bromophenyl)but-1-enyl]-2-ethylidene-N-(1-phenylethylidene)pent-3-enimidamide |
|---|---|
| PubChem CID | 144892656 |
| Molecular Formula | C25H27BrN2 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (Z,2E)-N'-[(E)-1-(3-bromophenyl)but-1-enyl]-2-ethylidene-N-(1-phenylethylidene)pent-3-enimidamide |
| SMILES | C/C=C\C(=C/C)C(=N/C(=C/CC)c1cccc(Br)c1)/N=C(\C)c1ccccc1 |
| InChI | InChI=1S/C25H27BrN2/c1-5-12-20(7-3)25(27-19(4)21-14-9-8-10-15-21)28-24(13-6-2)22-16-11-17-23(26)18-22/h5,7-18H,6H2,1-4H3/b12-5-,20-7+,24-13+,27-19+,28-25- |
| InChIKey | QRJZKCKQUVYZMF-JGRQGHGTSA-N |
| XLogP | 7.63 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|