C32H33BrN2 — CID 167016679
(Z,2E)-N-[1-(2-bromophenyl)ethylidene]-2-ethylidene-6-phenyl-N'-[(E)-1-phenylbut-1-enyl]hex-4-enimidamide (PubChem CID 167016679) has the molecular formula C32H33BrN2 and a molecular weight of 525.53 g/mol. Its IUPAC name is (Z,2E)-N-[1-(2-bromophenyl)ethylidene]-2-ethylidene-6-phenyl-N'-[(E)-1-phenylbut-1-enyl]hex-4-enimidamide.
| Compound Name | (Z,2E)-N-[1-(2-bromophenyl)ethylidene]-2-ethylidene-6-phenyl-N'-[(E)-1-phenylbut-1-enyl]hex-4-enimidamide |
|---|---|
| PubChem CID | 167016679 |
| Molecular Formula | C32H33BrN2 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | (Z,2E)-N-[1-(2-bromophenyl)ethylidene]-2-ethylidene-6-phenyl-N'-[(E)-1-phenylbut-1-enyl]hex-4-enimidamide |
| SMILES | C/C=C(C/C=C\Cc1ccccc1)/C(=N\C(=C\CC)c1ccccc1)/N=C(\C)c1ccccc1Br |
| InChI | InChI=1S/C32H33BrN2/c1-4-16-31(28-21-10-7-11-22-28)35-32(34-25(3)29-23-14-15-24-30(29)33)27(5-2)20-13-12-19-26-17-8-6-9-18-26/h5-18,21-24H,4,19-20H2,1-3H3/b13-12-,27-5+,31-16+,34-25+,35-32+ |
| InChIKey | GSJVGVLJJRVMFS-CUTFZTCCSA-N |
| XLogP | 9.24 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|