C14H19NO — CID 5371509
(Z,E)-N-methoxy-7-phenylhept-5-en-2-imine (PubChem CID 5371509) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (Z,E)-N-methoxy-7-phenylhept-5-en-2-imine.
| Compound Name | (Z,E)-N-methoxy-7-phenylhept-5-en-2-imine |
|---|---|
| PubChem CID | 5371509 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (Z,E)-N-methoxy-7-phenylhept-5-en-2-imine |
| SMILES | CO/N=C(/C)CC/C=C/Cc1ccccc1 |
| InChI | InChI=1S/C14H19NO/c1-13(15-16-2)9-5-3-6-10-14-11-7-4-8-12-14/h3-4,6-8,11-12H,5,9-10H2,1-2H3/b6-3+,15-13- |
| InChIKey | VGJDCGYGHXFWQK-UAPPOECJSA-N |
| XLogP | 3.59 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|