C18H25N — CID 54397231
9-phenyldodeca-2,6,9-trien-1-amine (PubChem CID 54397231) has the molecular formula C18H25N and a molecular weight of 255.41 g/mol. Its IUPAC name is 9-phenyldodeca-2,6,9-trien-1-amine.
| Compound Name | 9-phenyldodeca-2,6,9-trien-1-amine |
|---|---|
| PubChem CID | 54397231 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 9-phenyldodeca-2,6,9-trien-1-amine |
| SMILES | CCC=C(CC=CCCC=CCN)c1ccccc1 |
| InChI | InChI=1S/C18H25N/c1-2-12-17(18-14-9-7-10-15-18)13-8-5-3-4-6-11-16-19/h5-12,14-15H,2-4,13,16,19H2,1H3 |
| InChIKey | VKVYGFACNCQJGG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|