About [(Z)-3-phenylhex-3-enyl] prop-2-enoate
[(Z)-3-phenylhex-3-enyl] prop-2-enoate (PubChem CID 142724131) has the molecular formula C15H18O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is [(Z)-3-phenylhex-3-enyl] prop-2-enoate.
Molecular Properties
| Compound Name | [(Z)-3-phenylhex-3-enyl] prop-2-enoate |
| PubChem CID | 142724131 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | [(Z)-3-phenylhex-3-enyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC/C(=C/CC)c1ccccc1 |
| InChI | InChI=1S/C15H18O2/c1-3-8-13(11-12-17-15(16)4-2)14-9-6-5-7-10-14/h4-10H,2-3,11-12H2,1H3/b13-8- |
| InChIKey | MEQAHQPFVCOMCV-JYRVWZFOSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-3-phenylhex-3-enyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-3-phenylhex-3-enyl] prop-2-enoate?
The IUPAC name of [(Z)-3-phenylhex-3-enyl] prop-2-enoate (CID 142724131) is [(Z)-3-phenylhex-3-enyl] prop-2-enoate.
What is the SMILES notation for [(Z)-3-phenylhex-3-enyl] prop-2-enoate?
The canonical SMILES for [(Z)-3-phenylhex-3-enyl] prop-2-enoate is C=CC(=O)OCC/C(=C/CC)c1ccccc1.
What is the InChIKey of [(Z)-3-phenylhex-3-enyl] prop-2-enoate?
The InChIKey is MEQAHQPFVCOMCV-JYRVWZFOSA-N. The full InChI is InChI=1S/C15H18O2/c1-3-8-13(11-12-17-15(16)4-2)14-9-6-5-7-10-14/h4-10H,2-3,11-12H2,1H3/b13-8-.
What are the key properties of [(Z)-3-phenylhex-3-enyl] prop-2-enoate?
[(Z)-3-phenylhex-3-enyl] prop-2-enoate has a molecular weight of 230.31 g/mol, XLogP of 3.60, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-3-phenylhex-3-enyl] prop-2-enoate is sourced from PubChem (CID 142724131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).