C27H22BrN3 — CID 137385119
2-[(2E,4Z)-3-(3-bromophenyl)hexa-2,4-dienyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 137385119) has the molecular formula C27H22BrN3 and a molecular weight of 468.40 g/mol. Its IUPAC name is 2-[(2E,4Z)-3-(3-bromophenyl)hexa-2,4-dienyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[(2E,4Z)-3-(3-bromophenyl)hexa-2,4-dienyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 137385119 |
| Molecular Formula | C27H22BrN3 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 2-[(2E,4Z)-3-(3-bromophenyl)hexa-2,4-dienyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | C/C=C\C(=C/Cc1nc(-c2ccccc2)nc(-c2ccccc2)n1)c1cccc(Br)c1 |
| InChI | InChI=1S/C27H22BrN3/c1-2-10-20(23-15-9-16-24(28)19-23)17-18-25-29-26(21-11-5-3-6-12-21)31-27(30-25)22-13-7-4-8-14-22/h2-17,19H,18H2,1H3/b10-2-,20-17+ |
| InChIKey | YRRSAJJWGCVXIM-MCLPZSFYSA-N |
| XLogP | 7.17 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|