C20H24S — CID 123696902
hepta-2,4-dien-4-yl-methyl-diphenyl-λ4-sulfane (PubChem CID 123696902) has the molecular formula C20H24S and a molecular weight of 296.48 g/mol. Its IUPAC name is hepta-2,4-dien-4-yl-methyl-diphenyl-λ4-sulfane.
| Compound Name | hepta-2,4-dien-4-yl-methyl-diphenyl-λ4-sulfane |
|---|---|
| PubChem CID | 123696902 |
| Molecular Formula | C20H24S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | hepta-2,4-dien-4-yl-methyl-diphenyl-λ4-sulfane |
| SMILES | CC=CC(=CCC)S(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24S/c1-4-12-18(13-5-2)21(3,19-14-8-6-9-15-19)20-16-10-7-11-17-20/h4,6-17H,5H2,1-3H3 |
| InChIKey | KWMMCTPGLSBNIS-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|