C26H36S — CID 143613508
methyl-[(1E,3Z,5Z)-3-methylhepta-1,3,5-trienyl]-phenyl-[(2E,4E,5Z)-4-propylideneocta-2,5-dien-2-yl]-λ4-sulfane (PubChem CID 143613508) has the molecular formula C26H36S and a molecular weight of 380.64 g/mol. Its IUPAC name is methyl-[(1E,3Z,5Z)-3-methylhepta-1,3,5-trienyl]-phenyl-[(2E,4E,5Z)-4-propylideneocta-2,5-dien-2-yl]-λ4-sulfane.
| Compound Name | methyl-[(1E,3Z,5Z)-3-methylhepta-1,3,5-trienyl]-phenyl-[(2E,4E,5Z)-4-propylideneocta-2,5-dien-2-yl]-λ4-sulfane |
|---|---|
| PubChem CID | 143613508 |
| Molecular Formula | C26H36S |
| Molecular Weight | 380.64 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | methyl-[(1E,3Z,5Z)-3-methylhepta-1,3,5-trienyl]-phenyl-[(2E,4E,5Z)-4-propylideneocta-2,5-dien-2-yl]-λ4-sulfane |
| SMILES | C/C=C\C=C(C)/C=C/S(C)(/C(C)=C/C(/C=C\CC)=C/CC)c1ccccc1 |
| InChI | InChI=1S/C26H36S/c1-7-10-16-23(4)20-21-27(6,26-18-13-12-14-19-26)24(5)22-25(15-9-3)17-11-8-2/h7,10-22H,8-9H2,1-6H3/b10-7-,17-11-,21-20+,23-16-,24-22+,25-15+ |
| InChIKey | RDFIFWKXWQUYAK-RUBSOOSTSA-N |
| XLogP | 8.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.64 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|