C16H18N2 — CID 143057753
2-[(2Z,4E,6Z)-nona-2,4,6-trien-5-yl]-1H-benzimidazole (PubChem CID 143057753) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-[(2Z,4E,6Z)-nona-2,4,6-trien-5-yl]-1H-benzimidazole.
| Compound Name | 2-[(2Z,4E,6Z)-nona-2,4,6-trien-5-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 143057753 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2-[(2Z,4E,6Z)-nona-2,4,6-trien-5-yl]-1H-benzimidazole |
| SMILES | C/C=C\C=C(/C=C\CC)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H18N2/c1-3-5-9-13(10-6-4-2)16-17-14-11-7-8-12-15(14)18-16/h3,5-12H,4H2,1-2H3,(H,17,18)/b5-3-,10-6-,13-9+ |
| InChIKey | WMKRRMBGZADRCX-JXENZVEVSA-N |
| XLogP | 4.49 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|