C13H13ClN2 — CID 123996924
2-[(2Z)-4-chlorohexa-2,4-dien-3-yl]-1H-benzimidazole (PubChem CID 123996924) has the molecular formula C13H13ClN2 and a molecular weight of 232.71 g/mol. Its IUPAC name is 2-[(2Z)-4-chlorohexa-2,4-dien-3-yl]-1H-benzimidazole.
| Compound Name | 2-[(2Z)-4-chlorohexa-2,4-dien-3-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 123996924 |
| Molecular Formula | C13H13ClN2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-[(2Z)-4-chlorohexa-2,4-dien-3-yl]-1H-benzimidazole |
| SMILES | CC=C(Cl)/C(=C\C)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C13H13ClN2/c1-3-9(10(14)4-2)13-15-11-7-5-6-8-12(11)16-13/h3-8H,1-2H3,(H,15,16)/b9-3+,10-4? |
| InChIKey | JGXXTSJBWSCESU-LSTJWXOYSA-N |
| XLogP | 4.11 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|