C14H12N2 — CID 129191132
2-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-1H-benzimidazole (PubChem CID 129191132) has the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-1H-benzimidazole.
| Compound Name | 2-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 129191132 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-1H-benzimidazole |
| SMILES | C#C/C=C\C(=C/C)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H12N2/c1-3-5-8-11(4-2)14-15-12-9-6-7-10-13(12)16-14/h1,4-10H,2H3,(H,15,16)/b8-5-,11-4+ |
| InChIKey | FEWAGQQFOFARBA-CDXXIHCBSA-N |
| XLogP | 3.16 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|