C13H9N3O3 — CID 176531361
(2E)-5-(1H-benzimidazol-2-yl)-6-imino-4-oxohexa-2,5-dienoic acid (PubChem CID 176531361) has the molecular formula C13H9N3O3 and a molecular weight of 255.23 g/mol. Its IUPAC name is (2E)-5-(1H-benzimidazol-2-yl)-6-imino-4-oxohexa-2,5-dienoic acid.
| Compound Name | (2E)-5-(1H-benzimidazol-2-yl)-6-imino-4-oxohexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 176531361 |
| Molecular Formula | C13H9N3O3 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | (2E)-5-(1H-benzimidazol-2-yl)-6-imino-4-oxohexa-2,5-dienoic acid |
| SMILES | N=C=C(C(=O)/C=C/C(=O)O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C13H9N3O3/c14-7-8(11(17)5-6-12(18)19)13-15-9-3-1-2-4-10(9)16-13/h1-6,14H,(H,15,16)(H,18,19)/b6-5+ |
| InChIKey | ZMTCIQUINJKSBR-AATRIKPKSA-N |
| XLogP | 1.40 |
| TPSA | 106.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|